C30H48NOP — CID 171785277
2,4-ditert-butyl-N-(2,4-ditert-butylphenyl)-N-dimethylphosphorylaniline (PubChem CID 171785277) has the molecular formula C30H48NOP and a molecular weight of 469.69 g/mol. Its IUPAC name is 2,4-ditert-butyl-N-(2,4-ditert-butylphenyl)-N-dimethylphosphorylaniline.
| Compound Name | 2,4-ditert-butyl-N-(2,4-ditert-butylphenyl)-N-dimethylphosphorylaniline |
|---|---|
| PubChem CID | 171785277 |
| Molecular Formula | C30H48NOP |
| Molecular Weight | 469.69 g/mol |
| Exact Mass | 469.35 |
| IUPAC Name | 2,4-ditert-butyl-N-(2,4-ditert-butylphenyl)-N-dimethylphosphorylaniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2C(C)(C)C)P(C)(C)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H48NOP/c1-27(2,3)21-15-17-25(23(19-21)29(7,8)9)31(33(13,14)32)26-18-16-22(28(4,5)6)20-24(26)30(10,11)12/h15-20H,1-14H3 |
| InChIKey | SQAWUQLVNWHKMQ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|