C15H14O4S2 — CID 171798964
2-[[(3Z,5Z)-4-carboxyhepta-1,3,5-trien-3-yl]disulfanyl]benzoic acid (PubChem CID 171798964) has the molecular formula C15H14O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[[(3Z,5Z)-4-carboxyhepta-1,3,5-trien-3-yl]disulfanyl]benzoic acid.
| Compound Name | 2-[[(3Z,5Z)-4-carboxyhepta-1,3,5-trien-3-yl]disulfanyl]benzoic acid |
|---|---|
| PubChem CID | 171798964 |
| Molecular Formula | C15H14O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[[(3Z,5Z)-4-carboxyhepta-1,3,5-trien-3-yl]disulfanyl]benzoic acid |
| SMILES | C=C/C(SSc1ccccc1C(=O)O)=C(\C=C/C)C(=O)O |
| InChI | InChI=1S/C15H14O4S2/c1-3-7-10(14(16)17)12(4-2)20-21-13-9-6-5-8-11(13)15(18)19/h3-9H,2H2,1H3,(H,16,17)(H,18,19)/b7-3-,12-10- |
| InChIKey | CYTJTZOYZPJQDJ-WJTDARIZSA-N |
| XLogP | 4.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|