C12H19N3 — CID 171800067
(3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine (PubChem CID 171800067) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is (3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine.
| Compound Name | (3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 171800067 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (3E)-3-ethylidene-4-methyl-5-[(E)-pent-1-enyl]pyrazin-2-amine |
| SMILES | C/C=C1\C(N)=NC=C(/C=C/CCC)N1C |
| InChI | InChI=1S/C12H19N3/c1-4-6-7-8-10-9-14-12(13)11(5-2)15(10)3/h5,7-9H,4,6H2,1-3H3,(H2,13,14)/b8-7+,11-5+ |
| InChIKey | GJEYBJSWIVYORV-VAZWZHNFSA-N |
| XLogP | 2.39 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |