C15H9F7N4O2 — CID 171807179
6-(difluoromethyl)-2-(1,1-difluoropropan-2-yloxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one (PubChem CID 171807179) has the molecular formula C15H9F7N4O2 and a molecular weight of 410.25 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-(1,1-difluoropropan-2-yloxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 6-(difluoromethyl)-2-(1,1-difluoropropan-2-yloxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 171807179 |
| Molecular Formula | C15H9F7N4O2 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 6-(difluoromethyl)-2-(1,1-difluoropropan-2-yloxy)-7-(3,4,5-trifluorophenyl)-3H-imidazo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CC(Oc1nn2c(-c3cc(F)c(F)c(F)c3)c(C(F)F)nc2c(=O)[nH]1)C(F)F |
| InChI | InChI=1S/C15H9F7N4O2/c1-4(11(19)20)28-15-24-14(27)13-23-9(12(21)22)10(26(13)25-15)5-2-6(16)8(18)7(17)3-5/h2-4,11-12H,1H3,(H,24,25,27) |
| InChIKey | PXZHEUOLBAYBDX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|