C12H12F2N4O2 — CID 171813868
1-[3-[6-(2,2-difluoroethoxy)pyridazin-3-yl]pyrazin-2-yl]ethanol (PubChem CID 171813868) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[3-[6-(2,2-difluoroethoxy)pyridazin-3-yl]pyrazin-2-yl]ethanol.
| Compound Name | 1-[3-[6-(2,2-difluoroethoxy)pyridazin-3-yl]pyrazin-2-yl]ethanol |
|---|---|
| PubChem CID | 171813868 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[3-[6-(2,2-difluoroethoxy)pyridazin-3-yl]pyrazin-2-yl]ethanol |
| SMILES | CC(O)c1nccnc1-c1ccc(OCC(F)F)nn1 |
| InChI | InChI=1S/C12H12F2N4O2/c1-7(19)11-12(16-5-4-15-11)8-2-3-10(18-17-8)20-6-9(13)14/h2-5,7,9,19H,6H2,1H3 |
| InChIKey | KVWOBVRYHFYPAM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |