C19H17F2N3O2S — CID 171835735
4-acetamido-N-[4-(5,6-difluoro-1,3-benzothiazol-2-yl)phenyl]butanamide (PubChem CID 171835735) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is 4-acetamido-N-[4-(5,6-difluoro-1,3-benzothiazol-2-yl)phenyl]butanamide.
| Compound Name | 4-acetamido-N-[4-(5,6-difluoro-1,3-benzothiazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 171835735 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-acetamido-N-[4-(5,6-difluoro-1,3-benzothiazol-2-yl)phenyl]butanamide |
| SMILES | CC(=O)NCCCC(=O)Nc1ccc(-c2nc3cc(F)c(F)cc3s2)cc1 |
| InChI | InChI=1S/C19H17F2N3O2S/c1-11(25)22-8-2-3-18(26)23-13-6-4-12(5-7-13)19-24-16-9-14(20)15(21)10-17(16)27-19/h4-7,9-10H,2-3,8H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | MHLGJDMOEGLUMA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|