C19H22N6 — CID 171844280
N-(pyridin-3-ylmethyl)spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-amine (PubChem CID 171844280) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-amine.
| Compound Name | N-(pyridin-3-ylmethyl)spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-amine |
|---|---|
| PubChem CID | 171844280 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-(pyridin-3-ylmethyl)spiro[1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene-6,4'-piperidine]-2-amine |
| SMILES | c1cncc(CNc2c3c(nc4ccnn24)C2(CCNCC2)CC3)c1 |
| InChI | InChI=1S/C19H22N6/c1-2-14(12-21-8-1)13-22-18-15-3-5-19(6-10-20-11-7-19)17(15)24-16-4-9-23-25(16)18/h1-2,4,8-9,12,20,22H,3,5-7,10-11,13H2 |
| InChIKey | XNIWWWGXOYWVOL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |