C18H20BrN5O3 — CID 171851709
[(3R)-4-bromo-3-(2-nitroanilino)piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 171851709) has the molecular formula C18H20BrN5O3 and a molecular weight of 434.29 g/mol. Its IUPAC name is [(3R)-4-bromo-3-(2-nitroanilino)piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-4-bromo-3-(2-nitroanilino)piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 171851709 |
| Molecular Formula | C18H20BrN5O3 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [(3R)-4-bromo-3-(2-nitroanilino)piperidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2CCC(Br)[C@H](Nc3ccccc3[N+](=O)[O-])C2)c1 |
| InChI | InChI=1S/C18H20BrN5O3/c1-20-13-8-12(9-21-10-13)18(25)23-7-6-14(19)16(11-23)22-15-4-2-3-5-17(15)24(26)27/h2-5,8-10,14,16,20,22H,6-7,11H2,1H3/t14?,16-/m1/s1 |
| InChIKey | OKNAOVYACDFWFC-BZSJEYESSA-N |
| XLogP | 3.12 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|