C17H17N3O4 — CID 171855591
benzyl N-[3-(3-cyano-2-pyridinyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855591) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is benzyl N-[3-(3-cyano-2-pyridinyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-cyano-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855591 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | benzyl N-[3-(3-cyano-2-pyridinyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | N#Cc1cccnc1C(O)C(O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17N3O4/c18-9-13-7-4-8-19-15(13)16(22)14(21)10-20-17(23)24-11-12-5-2-1-3-6-12/h1-8,14,16,21-22H,10-11H2,(H,20,23) |
| InChIKey | ACDKYNWWEUQFGT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |