C14H18O6 — CID 171866656
ethyl 3-(4-ethoxy-3-formylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171866656) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is ethyl 3-(4-ethoxy-3-formylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(4-ethoxy-3-formylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866656 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | ethyl 3-(4-ethoxy-3-formylphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(OCC)c(C=O)c1 |
| InChI | InChI=1S/C14H18O6/c1-3-19-11-6-5-9(7-10(11)8-15)12(16)13(17)14(18)20-4-2/h5-8,12-13,16-17H,3-4H2,1-2H3 |
| InChIKey | LTAGEZFCYSTBJX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|