C21H23N3O4S — CID 171889240
benzyl N-[3,4-dihydroxy-4-[4-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]butyl]carbamate (PubChem CID 171889240) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-[4-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-[4-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 171889240 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-[4-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc(-n2cc[nH]c2=S)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O4S/c25-18(10-11-23-21(27)28-14-15-4-2-1-3-5-15)19(26)16-6-8-17(9-7-16)24-13-12-22-20(24)29/h1-9,12-13,18-19,25-26H,10-11,14H2,(H,22,29)(H,23,27) |
| InChIKey | QGLPFEDXCKFGFY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|