C12H15N3O4 — CID 171897558
ethyl 3,4-dihydroxy-4-pyrazolo[1,5-a]pyrimidin-3-ylbutanoate (PubChem CID 171897558) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-pyrazolo[1,5-a]pyrimidin-3-ylbutanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-pyrazolo[1,5-a]pyrimidin-3-ylbutanoate |
|---|---|
| PubChem CID | 171897558 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-pyrazolo[1,5-a]pyrimidin-3-ylbutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnn2cccnc12 |
| InChI | InChI=1S/C12H15N3O4/c1-2-19-10(17)6-9(16)11(18)8-7-14-15-5-3-4-13-12(8)15/h3-5,7,9,11,16,18H,2,6H2,1H3 |
| InChIKey | NFWKWVPCTOABFI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |