C9H13N3O3 — CID 171898628
3,4-dihydroxy-4-(6-methylpyrazin-2-yl)butanamide (PubChem CID 171898628) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(6-methylpyrazin-2-yl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(6-methylpyrazin-2-yl)butanamide |
|---|---|
| PubChem CID | 171898628 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3,4-dihydroxy-4-(6-methylpyrazin-2-yl)butanamide |
| SMILES | Cc1cncc(C(O)C(O)CC(N)=O)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-5-3-11-4-6(12-5)9(15)7(13)2-8(10)14/h3-4,7,9,13,15H,2H2,1H3,(H2,10,14) |
| InChIKey | NPACJULSNQTAKS-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |