C20H18F3N3O4 — CID 171903979
N-(8-methoxy-5H-chromeno[2,3-c]pyridin-5-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903979) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-(8-methoxy-5H-chromeno[2,3-c]pyridin-5-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(8-methoxy-5H-chromeno[2,3-c]pyridin-5-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903979 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(8-methoxy-5H-chromeno[2,3-c]pyridin-5-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | COc1ccc2c(c1)Oc1cnccc1C2NC(=O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C20H18F3N3O4/c1-29-10-2-3-11-14(8-10)30-15-9-24-7-6-12(15)17(11)26-19(28)13-4-5-16(20(21,22)23)25-18(13)27/h2-3,6-9,13,16-17H,4-5H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | UFSXWXKAXJEQEN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|