C10H8F3NO3 — CID 171919130
6,6-dimethyl-3-(trifluoromethyl)-7H-2,1-benzoxazole-4,5-dione (PubChem CID 171919130) has the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. Its IUPAC name is 6,6-dimethyl-3-(trifluoromethyl)-7H-2,1-benzoxazole-4,5-dione.
| Compound Name | 6,6-dimethyl-3-(trifluoromethyl)-7H-2,1-benzoxazole-4,5-dione |
|---|---|
| PubChem CID | 171919130 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 6,6-dimethyl-3-(trifluoromethyl)-7H-2,1-benzoxazole-4,5-dione |
| SMILES | CC1(C)Cc2noc(C(F)(F)F)c2C(=O)C1=O |
| InChI | InChI=1S/C10H8F3NO3/c1-9(2)3-4-5(6(15)7(9)16)8(17-14-4)10(11,12)13/h3H2,1-2H3 |
| InChIKey | PEVZBKXONTXDMR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|