C15H30F6N2O4S2 — CID 171931212
2-methyl-3-propan-2-ylnonan-3-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 171931212) has the molecular formula C15H30F6N2O4S2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 2-methyl-3-propan-2-ylnonan-3-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 2-methyl-3-propan-2-ylnonan-3-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 171931212 |
| Molecular Formula | C15H30F6N2O4S2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-methyl-3-propan-2-ylnonan-3-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCC(N)(C(C)C)C(C)C.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H29N.C2HF6NO4S2/c1-6-7-8-9-10-13(14,11(2)3)12(4)5;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h11-12H,6-10,14H2,1-5H3;9H |
| InChIKey | ZZHQDZHKGBBJRZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|