C15H10F2IO9S- — CID 172504941
1,1-difluoro-2-(5-iodo-4-oxospiro[1,3-benzodioxine-2,5'-7-oxabicyclo[2.2.1]heptane]-2'-yl)oxy-2-oxoethanesulfonate (PubChem CID 172504941) has the molecular formula C15H10F2IO9S- and a molecular weight of 531.20 g/mol. Its IUPAC name is 1,1-difluoro-2-(5-iodo-4-oxospiro[1,3-benzodioxine-2,5'-7-oxabicyclo[2.2.1]heptane]-2'-yl)oxy-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-(5-iodo-4-oxospiro[1,3-benzodioxine-2,5'-7-oxabicyclo[2.2.1]heptane]-2'-yl)oxy-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 172504941 |
| Molecular Formula | C15H10F2IO9S- |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 530.91 |
| IUPAC Name | 1,1-difluoro-2-(5-iodo-4-oxospiro[1,3-benzodioxine-2,5'-7-oxabicyclo[2.2.1]heptane]-2'-yl)oxy-2-oxoethanesulfonate |
| SMILES | O=C1OC2(CC3OC2CC3OC(=O)C(F)(F)S(=O)(=O)[O-])Oc2cccc(I)c21 |
| InChI | InChI=1S/C15H11F2IO9S/c16-15(17,28(21,22)23)13(20)25-8-4-10-14(5-9(8)24-10)26-7-3-1-2-6(18)11(7)12(19)27-14/h1-3,8-10H,4-5H2,(H,21,22,23)/p-1 |
| InChIKey | NESUZESVDYBTFO-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|