C15H10F2I2O8S2 — CID 172504800
2-(6,7-diiodo-4-oxospiro[1,3-benzodioxine-2,5'-7-thiabicyclo[2.2.1]heptane]-2'-yl)oxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 172504800) has the molecular formula C15H10F2I2O8S2 and a molecular weight of 674.17 g/mol. Its IUPAC name is 2-(6,7-diiodo-4-oxospiro[1,3-benzodioxine-2,5'-7-thiabicyclo[2.2.1]heptane]-2'-yl)oxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(6,7-diiodo-4-oxospiro[1,3-benzodioxine-2,5'-7-thiabicyclo[2.2.1]heptane]-2'-yl)oxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 172504800 |
| Molecular Formula | C15H10F2I2O8S2 |
| Molecular Weight | 674.17 g/mol |
| Exact Mass | 673.79 |
| IUPAC Name | 2-(6,7-diiodo-4-oxospiro[1,3-benzodioxine-2,5'-7-thiabicyclo[2.2.1]heptane]-2'-yl)oxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2(CC3SC2CC3OC(=O)C(F)(F)S(=O)(=O)O)Oc2cc(I)c(I)cc21 |
| InChI | InChI=1S/C15H10F2I2O8S2/c16-15(17,29(22,23)24)13(21)25-9-3-11-14(4-10(9)28-11)26-8-2-7(19)6(18)1-5(8)12(20)27-14/h1-2,9-11H,3-4H2,(H,22,23,24) |
| InChIKey | BGSCTIHVZOALRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|