C15H13F2IO8S — CID 172504867
1,1-difluoro-2-(8-iodo-4-oxospiro[1,3-benzodioxine-2,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid (PubChem CID 172504867) has the molecular formula C15H13F2IO8S and a molecular weight of 518.23 g/mol. Its IUPAC name is 1,1-difluoro-2-(8-iodo-4-oxospiro[1,3-benzodioxine-2,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(8-iodo-4-oxospiro[1,3-benzodioxine-2,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 172504867 |
| Molecular Formula | C15H13F2IO8S |
| Molecular Weight | 518.23 g/mol |
| Exact Mass | 517.93 |
| IUPAC Name | 1,1-difluoro-2-(8-iodo-4-oxospiro[1,3-benzodioxine-2,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2(CCC(OC(=O)C(F)(F)S(=O)(=O)O)CC2)Oc2c(I)cccc21 |
| InChI | InChI=1S/C15H13F2IO8S/c16-15(17,27(21,22)23)13(20)24-8-4-6-14(7-5-8)25-11-9(12(19)26-14)2-1-3-10(11)18/h1-3,8H,4-7H2,(H,21,22,23) |
| InChIKey | LRJCDUAOVVQCGF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|