C15H23F2O7S- — CID 162503922
2-[[5,6-bis(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]oxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 162503922) has the molecular formula C15H23F2O7S- and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-[[5,6-bis(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]oxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[[5,6-bis(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 162503922 |
| Molecular Formula | C15H23F2O7S- |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[[5,6-bis(2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CC(C)(O)C1C2CC(OC(=O)C(F)(F)S(=O)(=O)[O-])C(C2)C1C(C)(C)O |
| InChI | InChI=1S/C15H24F2O7S/c1-13(2,19)10-7-5-8(11(10)14(3,4)20)9(6-7)24-12(18)15(16,17)25(21,22)23/h7-11,19-20H,5-6H2,1-4H3,(H,21,22,23)/p-1 |
| InChIKey | TYCURQXFVDCORS-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|