C18H16ClN5O — CID 172521221
5-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-7-methyl-3-oxo-4H-quinoxaline-2-carbonitrile (PubChem CID 172521221) has the molecular formula C18H16ClN5O and a molecular weight of 353.81 g/mol. Its IUPAC name is 5-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-7-methyl-3-oxo-4H-quinoxaline-2-carbonitrile.
| Compound Name | 5-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-7-methyl-3-oxo-4H-quinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 172521221 |
| Molecular Formula | C18H16ClN5O |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-[(1R)-1-[(6-chloro-2-methyl-3-pyridinyl)amino]ethyl]-7-methyl-3-oxo-4H-quinoxaline-2-carbonitrile |
| SMILES | Cc1cc([C@@H](C)Nc2ccc(Cl)nc2C)c2[nH]c(=O)c(C#N)nc2c1 |
| InChI | InChI=1S/C18H16ClN5O/c1-9-6-12(10(2)21-13-4-5-16(19)22-11(13)3)17-14(7-9)23-15(8-20)18(25)24-17/h4-7,10,21H,1-3H3,(H,24,25)/t10-/m1/s1 |
| InChIKey | YFXVZPXXNJYKQF-SNVBAGLBSA-N |
| XLogP | 3.63 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|