C18H28BrF3O2Si — CID 172541656
[2-(4-bromo-2-fluoro-6-methylphenoxy)-2,2-difluoroethoxy]-tri(propan-2-yl)silane (PubChem CID 172541656) has the molecular formula C18H28BrF3O2Si and a molecular weight of 441.40 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoro-6-methylphenoxy)-2,2-difluoroethoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-(4-bromo-2-fluoro-6-methylphenoxy)-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 172541656 |
| Molecular Formula | C18H28BrF3O2Si |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-(4-bromo-2-fluoro-6-methylphenoxy)-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
| SMILES | Cc1cc(Br)cc(F)c1OC(F)(F)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H28BrF3O2Si/c1-11(2)25(12(3)4,13(5)6)23-10-18(21,22)24-17-14(7)8-15(19)9-16(17)20/h8-9,11-13H,10H2,1-7H3 |
| InChIKey | AKXHVMYNNFGQCT-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|