C17H14BrF3N6 — CID 172543212
(4R,6R)-4-azido-12-bromo-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-triene (PubChem CID 172543212) has the molecular formula C17H14BrF3N6 and a molecular weight of 439.24 g/mol. Its IUPAC name is (4R,6R)-4-azido-12-bromo-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-triene.
| Compound Name | (4R,6R)-4-azido-12-bromo-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-triene |
|---|---|
| PubChem CID | 172543212 |
| Molecular Formula | C17H14BrF3N6 |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | (4R,6R)-4-azido-12-bromo-8-[4-(trifluoromethyl)phenyl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-triene |
| SMILES | [N-]=[N+]=N[C@@H]1C[C@@H]2CN(c3ccc(C(F)(F)F)cc3)c3ccc(Br)nc3N2C1 |
| InChI | InChI=1S/C17H14BrF3N6/c18-15-6-5-14-16(23-15)27-8-11(24-25-22)7-13(27)9-26(14)12-3-1-10(2-4-12)17(19,20)21/h1-6,11,13H,7-9H2/t11-,13-/m1/s1 |
| InChIKey | FAKYWYBCKZTPBK-DGCLKSJQSA-N |
| XLogP | 5.27 |
| TPSA | 68.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|