C28H25ClF4N5O3+ — CID 172564403
(9S)-N-[5-chloro-2-fluoro-4-[6-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxy-3-pyridinyl]phenyl]-5-oxo-4-aza-12-azoniatricyclo[7.2.1.02,7]dodeca-1(12),2,6-triene-12-carboxamide (PubChem CID 172564403) has the molecular formula C28H25ClF4N5O3+ and a molecular weight of 590.99 g/mol. Its IUPAC name is (9S)-N-[5-chloro-2-fluoro-4-[6-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxy-3-pyridinyl]phenyl]-5-oxo-4-aza-12-azoniatricyclo[7.2.1.02,7]dodeca-1(12),2,6-triene-12-carboxamide.
| Compound Name | (9S)-N-[5-chloro-2-fluoro-4-[6-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxy-3-pyridinyl]phenyl]-5-oxo-4-aza-12-azoniatricyclo[7.2.1.02,7]dodeca-1(12),2,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 172564403 |
| Molecular Formula | C28H25ClF4N5O3+ |
| Molecular Weight | 590.99 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | (9S)-N-[5-chloro-2-fluoro-4-[6-[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]oxy-3-pyridinyl]phenyl]-5-oxo-4-aza-12-azoniatricyclo[7.2.1.02,7]dodeca-1(12),2,6-triene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(-c2ccc(O[C@H]3CCN(CC(F)(F)F)C3)nc2)cc1F)[N+]1=C2CC[C@H]1Cc1cc(=O)[nH]cc12 |
| InChI | InChI=1S/C28H24ClF4N5O3/c29-21-10-23(36-27(40)38-17-2-3-24(38)20-12-34-25(39)8-16(20)7-17)22(30)9-19(21)15-1-4-26(35-11-15)41-18-5-6-37(13-18)14-28(31,32)33/h1,4,8-12,17-18H,2-3,5-7,13-14H2,(H,36,40)/p+1/t17-,18-/m0/s1 |
| InChIKey | KKXYSCQLTZHRDZ-ROUUACIJSA-O |
| XLogP | 5.00 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.99 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|