C23H20ClF2N5O3 — CID 170261690
(1R,9S)-N-[5-chloro-2-fluoro-4-[6-(2-fluoroethoxy)-3-pyridinyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 170261690) has the molecular formula C23H20ClF2N5O3 and a molecular weight of 487.89 g/mol. Its IUPAC name is (1R,9S)-N-[5-chloro-2-fluoro-4-[6-(2-fluoroethoxy)-3-pyridinyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[6-(2-fluoroethoxy)-3-pyridinyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 170261690 |
| Molecular Formula | C23H20ClF2N5O3 |
| Molecular Weight | 487.89 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[6-(2-fluoroethoxy)-3-pyridinyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(-c2ccc(OCCF)nc2)cc1F)N1[C@H]2CC[C@@H]1c1n[nH]c(=O)cc1C2 |
| InChI | InChI=1S/C23H20ClF2N5O3/c24-16-10-18(17(26)9-15(16)12-1-4-21(27-11-12)34-6-5-25)28-23(33)31-14-2-3-19(31)22-13(7-14)8-20(32)29-30-22/h1,4,8-11,14,19H,2-3,5-7H2,(H,28,33)(H,29,32)/t14-,19+/m0/s1 |
| InChIKey | BVWGVMHHEOQZCN-IFXJQAMLSA-N |
| XLogP | 4.27 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |