C24H20ClF4N5O4 — CID 172564523
(1R,9S)-N-[5-chloro-2-fluoro-4-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxymethyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 172564523) has the molecular formula C24H20ClF4N5O4 and a molecular weight of 553.90 g/mol. Its IUPAC name is (1R,9S)-N-[5-chloro-2-fluoro-4-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxymethyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxymethyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 172564523 |
| Molecular Formula | C24H20ClF4N5O4 |
| Molecular Weight | 553.90 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxymethyl]phenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(COc2cccc(OCC(F)(F)F)n2)cc1F)N1[C@H]2CC[C@@H]1c1n[nH]c(=O)cc1C2 |
| InChI | InChI=1S/C24H20ClF4N5O4/c25-15-9-17(30-23(36)34-14-4-5-18(34)22-12(6-14)8-19(35)32-33-22)16(26)7-13(15)10-37-20-2-1-3-21(31-20)38-11-24(27,28)29/h1-3,7-9,14,18H,4-6,10-11H2,(H,30,36)(H,32,35)/t14-,18+/m0/s1 |
| InChIKey | LFSWORIHQQBUHR-KBXCAEBGSA-N |
| XLogP | 4.77 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |