C28H29ClFN5O3S — CID 172564318
(1R,9S)-N-[5-chloro-4-[6-(1-ethylidenethian-4-yl)oxy-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 172564318) has the molecular formula C28H29ClFN5O3S and a molecular weight of 570.09 g/mol. Its IUPAC name is (1R,9S)-N-[5-chloro-4-[6-(1-ethylidenethian-4-yl)oxy-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N-[5-chloro-4-[6-(1-ethylidenethian-4-yl)oxy-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 172564318 |
| Molecular Formula | C28H29ClFN5O3S |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | (1R,9S)-N-[5-chloro-4-[6-(1-ethylidenethian-4-yl)oxy-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | CC=S1CCC(Oc2ccc(-c3cc(F)c(NC(=O)N4[C@H]5CC[C@@H]4c4n[nH]c(=O)cc4C5)cc3Cl)cn2)CC1 |
| InChI | InChI=1S/C28H29ClFN5O3S/c1-2-39-9-7-19(8-10-39)38-26-6-3-16(15-31-26)20-13-22(30)23(14-21(20)29)32-28(37)35-18-4-5-24(35)27-17(11-18)12-25(36)33-34-27/h2-3,6,12-15,18-19,24H,4-5,7-11H2,1H3,(H,32,37)(H,33,36)/t18-,19?,24+,39?/m0/s1 |
| InChIKey | XDFCATPOIOKEDJ-BQZISSPISA-N |
| XLogP | 5.55 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|