About 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one
2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one (PubChem CID 172578585) has the molecular formula C19H14F6O3
and a molecular weight of 404.31 g/mol. Its IUPAC name is 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 172578585 |
| Molecular Formula | C19H14F6O3 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one |
| SMILES | COC(c1cc(C(F)(F)F)ccc1C(F)(F)F)C1C(=O)c2ccccc2C1O |
| InChI | InChI=1S/C19H14F6O3/c1-28-17(14-15(26)10-4-2-3-5-11(10)16(14)27)12-8-9(18(20,21)22)6-7-13(12)19(23,24)25/h2-8,14-15,17,26H,1H3 |
| InChIKey | HBKSSBGZXBXQAX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one (CID 172578585) is 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one is COC(c1cc(C(F)(F)F)ccc1C(F)(F)F)C1C(=O)c2ccccc2C1O.
What is the InChIKey of 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is HBKSSBGZXBXQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F6O3/c1-28-17(14-15(26)10-4-2-3-5-11(10)16(14)27)12-8-9(18(20,21)22)6-7-13(12)19(23,24)25/h2-8,14-15,17,26H,1H3.
What are the key properties of 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one?
2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 404.31 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,5-bis(trifluoromethyl)phenyl]-methoxymethyl]-3-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 172578585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).