C31H45N7O4 — CID 172578926
2-[4-[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]phenyl]acetaldehyde;2-(hydroxymethyl)-2-(methylamino)propane-1,3-diol;prop-1-ene (PubChem CID 172578926) has the molecular formula C31H45N7O4 and a molecular weight of 579.75 g/mol. Its IUPAC name is 2-[4-[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]phenyl]acetaldehyde;2-(hydroxymethyl)-2-(methylamino)propane-1,3-diol;prop-1-ene.
| Compound Name | 2-[4-[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]phenyl]acetaldehyde;2-(hydroxymethyl)-2-(methylamino)propane-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 172578926 |
| Molecular Formula | C31H45N7O4 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | 2-[4-[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]phenyl]acetaldehyde;2-(hydroxymethyl)-2-(methylamino)propane-1,3-diol;prop-1-ene |
| SMILES | C=CC.CNC(CO)(CO)CO.N/C(=C\N(N)c1ccc(CC=O)cc1)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C23H26N6O.C5H13NO3.C3H6/c24-20(16-29(25)23-9-7-19(8-10-23)11-14-30)15-28(17-21-5-1-3-12-26-21)18-22-6-2-4-13-27-22;1-6-5(2-7,3-8)4-9;1-3-2/h1-10,12-14,16H,11,15,17-18,24-25H2;6-9H,2-4H2,1H3;3H,1H2,2H3/b20-16-;; |
| InChIKey | ZZYJWOREXFGQJB-PFNMRQQASA-N |
| XLogP | 1.51 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|