C21H30N6O4 — CID 172578853
(4R,5R)-6-[[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]methyl]oxane-2,4,5-triol (PubChem CID 172578853) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is (4R,5R)-6-[[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]methyl]oxane-2,4,5-triol.
| Compound Name | (4R,5R)-6-[[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]methyl]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 172578853 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (4R,5R)-6-[[amino-[(Z)-2-amino-3-[bis(pyridin-2-ylmethyl)amino]prop-1-enyl]amino]methyl]oxane-2,4,5-triol |
| SMILES | N/C(=C\N(N)CC1OC(O)C[C@@H](O)[C@H]1O)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C21H30N6O4/c22-15(11-27(23)14-19-21(30)18(28)9-20(29)31-19)10-26(12-16-5-1-3-7-24-16)13-17-6-2-4-8-25-17/h1-8,11,18-21,28-30H,9-10,12-14,22-23H2/b15-11-/t18-,19?,20?,21-/m1/s1 |
| InChIKey | DDUDHIUMMNOBJB-OIYGSBGJSA-N |
| XLogP | -0.72 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|