C22H26N6O — CID 144820253
(Z)-3-(N-amino-4-methoxyanilino)-1-N,1-N-bis(pyridin-2-ylmethyl)prop-2-ene-1,2-diamine (PubChem CID 144820253) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is (Z)-3-(N-amino-4-methoxyanilino)-1-N,1-N-bis(pyridin-2-ylmethyl)prop-2-ene-1,2-diamine.
| Compound Name | (Z)-3-(N-amino-4-methoxyanilino)-1-N,1-N-bis(pyridin-2-ylmethyl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 144820253 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (Z)-3-(N-amino-4-methoxyanilino)-1-N,1-N-bis(pyridin-2-ylmethyl)prop-2-ene-1,2-diamine |
| SMILES | COc1ccc(N(N)/C=C(\N)CN(Cc2ccccn2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C22H26N6O/c1-29-22-10-8-21(9-11-22)28(24)15-18(23)14-27(16-19-6-2-4-12-25-19)17-20-7-3-5-13-26-20/h2-13,15H,14,16-17,23-24H2,1H3/b18-15- |
| InChIKey | LFKGMIDKBJONKH-SDXDJHTJSA-N |
| XLogP | 2.67 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|