C16H32O2S2 — CID 172588636
2-(2-methylpropyl)-1,4-oxathiane (PubChem CID 172588636) has the molecular formula C16H32O2S2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1,4-oxathiane.
| Compound Name | 2-(2-methylpropyl)-1,4-oxathiane |
|---|---|
| PubChem CID | 172588636 |
| Molecular Formula | C16H32O2S2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-(2-methylpropyl)-1,4-oxathiane |
| SMILES | CC(C)CC1CSCCO1.CC(C)CC1CSCCO1 |
| InChI | InChI=1S/2C8H16OS/c2*1-7(2)5-8-6-10-4-3-9-8/h2*7-8H,3-6H2,1-2H3 |
| InChIKey | XLCRFQTUUGEMJI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |