C22H22N2O2S — CID 172601093
5-(cyclohexen-1-yl)-N-(4-methylsulfonylphenyl)isoquinolin-3-amine (PubChem CID 172601093) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-N-(4-methylsulfonylphenyl)isoquinolin-3-amine.
| Compound Name | 5-(cyclohexen-1-yl)-N-(4-methylsulfonylphenyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 172601093 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 5-(cyclohexen-1-yl)-N-(4-methylsulfonylphenyl)isoquinolin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc3c(C4=CCCCC4)cccc3cn2)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-27(25,26)19-12-10-18(11-13-19)24-22-14-21-17(15-23-22)8-5-9-20(21)16-6-3-2-4-7-16/h5-6,8-15H,2-4,7H2,1H3,(H,23,24) |
| InChIKey | CMEGJVWXYXFXFL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |