C18H16BrNO2 — CID 172635544
1-(2-bromo-4-methoxyphenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole (PubChem CID 172635544) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole |
|---|---|
| PubChem CID | 172635544 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)-1,3,4,9-tetrahydropyrano[3,4-b]indole |
| SMILES | COc1ccc(C2OCCc3c2[nH]c2ccccc32)c(Br)c1 |
| InChI | InChI=1S/C18H16BrNO2/c1-21-11-6-7-14(15(19)10-11)18-17-13(8-9-22-18)12-4-2-3-5-16(12)20-17/h2-7,10,18,20H,8-9H2,1H3 |
| InChIKey | IZIDQCRZIXZWSB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |