C17H15N5O2 — CID 172639926
4-[(4-acetylphenyl)diazenyl]-5-anilino-1,2-dihydropyrazol-3-one (PubChem CID 172639926) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-[(4-acetylphenyl)diazenyl]-5-anilino-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[(4-acetylphenyl)diazenyl]-5-anilino-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 172639926 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[(4-acetylphenyl)diazenyl]-5-anilino-1,2-dihydropyrazol-3-one |
| SMILES | CC(=O)c1ccc(/N=N/c2c(Nc3ccccc3)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C17H15N5O2/c1-11(23)12-7-9-14(10-8-12)19-20-15-16(21-22-17(15)24)18-13-5-3-2-4-6-13/h2-10H,1H3,(H3,18,21,22,24)/b20-19+ |
| InChIKey | ZQOVUUMPTMXIOR-FMQUCBEESA-N |
| XLogP | 4.06 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|