C20H8BrFN2O3 — CID 172640020
19-bromo-7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 172640020) has the molecular formula C20H8BrFN2O3 and a molecular weight of 423.20 g/mol. Its IUPAC name is 19-bromo-7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 19-bromo-7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 172640020 |
| Molecular Formula | C20H8BrFN2O3 |
| Molecular Weight | 423.20 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 19-bromo-7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cc(Br)ccc3[nH]c1c1oc3ccc(F)cc3c21 |
| InChI | InChI=1S/C20H8BrFN2O3/c21-7-1-3-11-9(5-7)13-15-16(20(26)24-19(15)25)14-10-6-8(22)2-4-12(10)27-18(14)17(13)23-11/h1-6,23H,(H,24,25,26) |
| InChIKey | WQKDXNVCGSOPPZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|