C36H43FN2O2S2 — CID 172651982
7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-dithiophen-2-ylphenazine (PubChem CID 172651982) has the molecular formula C36H43FN2O2S2 and a molecular weight of 618.88 g/mol. Its IUPAC name is 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-dithiophen-2-ylphenazine.
| Compound Name | 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-dithiophen-2-ylphenazine |
|---|---|
| PubChem CID | 172651982 |
| Molecular Formula | C36H43FN2O2S2 |
| Molecular Weight | 618.88 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-dithiophen-2-ylphenazine |
| SMILES | CCCCC(CC)COc1cc2nc3c(-c4cccs4)cc(F)c(-c4cccs4)c3nc2cc1OCC(CC)CCCC |
| InChI | InChI=1S/C36H43FN2O2S2/c1-5-9-13-24(7-3)22-40-30-20-28-29(21-31(30)41-23-25(8-4)14-10-6-2)39-36-34(33-16-12-18-43-33)27(37)19-26(35(36)38-28)32-15-11-17-42-32/h11-12,15-21,24-25H,5-10,13-14,22-23H2,1-4H3 |
| InChIKey | GNKZWNDRRPZHTG-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.88 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|