C52H61Br2FN2O2S4 — CID 172652000
1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-butyloctoxy)-2-fluorophenazine (PubChem CID 172652000) has the molecular formula C52H61Br2FN2O2S4 and a molecular weight of 1053.15 g/mol. Its IUPAC name is 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-butyloctoxy)-2-fluorophenazine.
| Compound Name | 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-butyloctoxy)-2-fluorophenazine |
|---|---|
| PubChem CID | 172652000 |
| Molecular Formula | C52H61Br2FN2O2S4 |
| Molecular Weight | 1053.15 g/mol |
| Exact Mass | 1050.20 |
| IUPAC Name | 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-butyloctoxy)-2-fluorophenazine |
| SMILES | CCCCCCC(CCCC)COc1cc2nc3c(-c4ccc(-c5ccc(Br)s5)s4)cc(F)c(-c4ccc(-c5ccc(Br)s5)s4)c3nc2cc1OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C52H61Br2FN2O2S4/c1-5-9-13-15-19-34(17-11-7-3)32-58-40-30-38-39(31-41(40)59-33-35(18-12-8-4)20-16-14-10-6-2)57-52-50(47-24-23-44(61-47)46-26-28-49(54)63-46)37(55)29-36(51(52)56-38)42-21-22-43(60-42)45-25-27-48(53)62-45/h21-31,34-35H,5-20,32-33H2,1-4H3 |
| InChIKey | UOALWBBUSUCIJH-UHFFFAOYSA-N |
| XLogP | 19.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.15 |
| LogP ≤ 5 | 19.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|