C44H47FN2O2S4 — CID 172651994
7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine (PubChem CID 172651994) has the molecular formula C44H47FN2O2S4 and a molecular weight of 783.14 g/mol. Its IUPAC name is 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine.
| Compound Name | 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine |
|---|---|
| PubChem CID | 172651994 |
| Molecular Formula | C44H47FN2O2S4 |
| Molecular Weight | 783.14 g/mol |
| Exact Mass | 782.25 |
| IUPAC Name | 7,8-bis(2-ethylhexoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine |
| SMILES | CCCCC(CC)COc1cc2nc3c(-c4ccc(-c5cccs5)s4)cc(F)c(-c4ccc(-c5cccs5)s4)c3nc2cc1OCC(CC)CCCC |
| InChI | InChI=1S/C44H47FN2O2S4/c1-5-9-13-28(7-3)26-48-34-24-32-33(25-35(34)49-27-29(8-4)14-10-6-2)47-44-42(41-20-19-40(53-41)38-16-12-22-51-38)31(45)23-30(43(44)46-32)36-17-18-39(52-36)37-15-11-21-50-37/h11-12,15-25,28-29H,5-10,13-14,26-27H2,1-4H3 |
| InChIKey | NZENYLNHULMPOY-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.14 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|