C44H57Br2FN2O2S2 — CID 172651995
1,4-bis(5-bromothiophen-2-yl)-7,8-bis(2-butyloctoxy)-2-fluorophenazine (PubChem CID 172651995) has the molecular formula C44H57Br2FN2O2S2 and a molecular weight of 888.89 g/mol. Its IUPAC name is 1,4-bis(5-bromothiophen-2-yl)-7,8-bis(2-butyloctoxy)-2-fluorophenazine.
| Compound Name | 1,4-bis(5-bromothiophen-2-yl)-7,8-bis(2-butyloctoxy)-2-fluorophenazine |
|---|---|
| PubChem CID | 172651995 |
| Molecular Formula | C44H57Br2FN2O2S2 |
| Molecular Weight | 888.89 g/mol |
| Exact Mass | 886.22 |
| IUPAC Name | 1,4-bis(5-bromothiophen-2-yl)-7,8-bis(2-butyloctoxy)-2-fluorophenazine |
| SMILES | CCCCCCC(CCCC)COc1cc2nc3c(-c4ccc(Br)s4)cc(F)c(-c4ccc(Br)s4)c3nc2cc1OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C44H57Br2FN2O2S2/c1-5-9-13-15-19-30(17-11-7-3)28-50-36-26-34-35(27-37(36)51-29-31(18-12-8-4)20-16-14-10-6-2)49-44-42(39-22-24-41(46)53-39)33(47)25-32(43(44)48-34)38-21-23-40(45)52-38/h21-27,30-31H,5-20,28-29H2,1-4H3 |
| InChIKey | OQJBNGGNOKVZLZ-UHFFFAOYSA-N |
| XLogP | 16.22 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.89 |
| LogP ≤ 5 | 16.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|