C44H45Br2FN2O2S4 — CID 172651996
1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-ethylhexoxy)-2-fluorophenazine (PubChem CID 172651996) has the molecular formula C44H45Br2FN2O2S4 and a molecular weight of 940.93 g/mol. Its IUPAC name is 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-ethylhexoxy)-2-fluorophenazine.
| Compound Name | 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-ethylhexoxy)-2-fluorophenazine |
|---|---|
| PubChem CID | 172651996 |
| Molecular Formula | C44H45Br2FN2O2S4 |
| Molecular Weight | 940.93 g/mol |
| Exact Mass | 938.07 |
| IUPAC Name | 1,4-bis[5-(5-bromothiophen-2-yl)thiophen-2-yl]-7,8-bis(2-ethylhexoxy)-2-fluorophenazine |
| SMILES | CCCCC(CC)COc1cc2nc3c(-c4ccc(-c5ccc(Br)s5)s4)cc(F)c(-c4ccc(-c5ccc(Br)s5)s4)c3nc2cc1OCC(CC)CCCC |
| InChI | InChI=1S/C44H45Br2FN2O2S4/c1-5-9-11-26(7-3)24-50-32-22-30-31(23-33(32)51-25-27(8-4)12-10-6-2)49-44-42(39-16-15-36(53-39)38-18-20-41(46)55-38)29(47)21-28(43(44)48-30)34-13-14-35(52-34)37-17-19-40(45)54-37/h13-23,26-27H,5-12,24-25H2,1-4H3 |
| InChIKey | QGHKPQWYNUHODA-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.93 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|