C52H63FN2O2S4 — CID 172651998
7,8-bis(2-butyloctoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine (PubChem CID 172651998) has the molecular formula C52H63FN2O2S4 and a molecular weight of 895.35 g/mol. Its IUPAC name is 7,8-bis(2-butyloctoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine.
| Compound Name | 7,8-bis(2-butyloctoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine |
|---|---|
| PubChem CID | 172651998 |
| Molecular Formula | C52H63FN2O2S4 |
| Molecular Weight | 895.35 g/mol |
| Exact Mass | 894.38 |
| IUPAC Name | 7,8-bis(2-butyloctoxy)-2-fluoro-1,4-bis(5-thiophen-2-ylthiophen-2-yl)phenazine |
| SMILES | CCCCCCC(CCCC)COc1cc2nc3c(-c4ccc(-c5cccs5)s4)cc(F)c(-c4ccc(-c5cccs5)s4)c3nc2cc1OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C52H63FN2O2S4/c1-5-9-13-15-21-36(19-11-7-3)34-56-42-32-40-41(33-43(42)57-35-37(20-12-8-4)22-16-14-10-6-2)55-52-50(49-28-27-48(61-49)46-24-18-30-59-46)39(53)31-38(51(52)54-40)44-25-26-47(60-44)45-23-17-29-58-45/h17-18,23-33,36-37H,5-16,19-22,34-35H2,1-4H3 |
| InChIKey | HWJIXGSPGGOCSJ-UHFFFAOYSA-N |
| XLogP | 18.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.35 |
| LogP ≤ 5 | 18.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|