C44H46Br2F2N2O2S2 — CID 102131349
5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(4-octoxyphenyl)quinoxaline (PubChem CID 102131349) has the molecular formula C44H46Br2F2N2O2S2 and a molecular weight of 896.80 g/mol. Its IUPAC name is 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(4-octoxyphenyl)quinoxaline.
| Compound Name | 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(4-octoxyphenyl)quinoxaline |
|---|---|
| PubChem CID | 102131349 |
| Molecular Formula | C44H46Br2F2N2O2S2 |
| Molecular Weight | 896.80 g/mol |
| Exact Mass | 894.13 |
| IUPAC Name | 5,8-bis(5-bromothiophen-2-yl)-6,7-difluoro-2,3-bis(4-octoxyphenyl)quinoxaline |
| SMILES | CCCCCCCCOc1ccc(-c2nc3c(-c4ccc(Br)s4)c(F)c(F)c(-c4ccc(Br)s4)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H46Br2F2N2O2S2/c1-3-5-7-9-11-13-27-51-31-19-15-29(16-20-31)41-42(30-17-21-32(22-18-30)52-28-14-12-10-8-6-4-2)50-44-38(34-24-26-36(46)54-34)40(48)39(47)37(43(44)49-41)33-23-25-35(45)53-33/h15-26H,3-14,27-28H2,1-2H3 |
| InChIKey | AYLHEBCCBPRGKU-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.80 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|