C39H45Cl2F3N8O3 — CID 172677379
2-[4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 172677379) has the molecular formula C39H45Cl2F3N8O3 and a molecular weight of 801.74 g/mol. Its IUPAC name is 2-[4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | 2-[4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 172677379 |
| Molecular Formula | C39H45Cl2F3N8O3 |
| Molecular Weight | 801.74 g/mol |
| Exact Mass | 800.29 |
| IUPAC Name | 2-[4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethyl 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCN(CCOC(=O)CCCc4ccc(N(CCCl)CCCl)cc4)CC3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C39H45Cl2F3N8O3/c1-45-37(54)32-6-2-3-7-34(32)48-36-33(39(42,43)44)27-46-38(49-36)47-29-11-15-31(16-12-29)52-23-21-50(22-24-52)25-26-55-35(53)8-4-5-28-9-13-30(14-10-28)51(19-17-40)20-18-41/h2-3,6-7,9-16,27H,4-5,8,17-26H2,1H3,(H,45,54)(H2,46,47,48,49) |
| InChIKey | NTOYIQULHFDSNY-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|