C36H43N3O5 — CID 172686948
methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-[5-(4-heptoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoate (PubChem CID 172686948) has the molecular formula C36H43N3O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-[5-(4-heptoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-[5-(4-heptoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 172686948 |
| Molecular Formula | C36H43N3O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-2-[4-[5-(4-heptoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]propanoate |
| SMILES | CCCCCCCOc1ccc(-c2nc(-c3ccc([C@](C)(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)OC)cc3)no2)cc1 |
| InChI | InChI=1S/C36H43N3O5/c1-7-8-9-10-11-24-43-30-22-16-27(17-23-30)33-37-31(39-44-33)25-12-20-29(21-13-25)36(5,34(41)42-6)38-32(40)26-14-18-28(19-15-26)35(2,3)4/h12-23H,7-11,24H2,1-6H3,(H,38,40)/t36-/m0/s1 |
| InChIKey | BDYBDXGFXFOIQT-BHVANESWSA-N |
| XLogP | 7.87 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|