C36H43N3O5 — CID 155084773
(2S)-2-[[2-(4-tert-butylphenyl)-2-oxoethyl]amino]-3-[4-[3-(4-heptoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]propanoic acid (PubChem CID 155084773) has the molecular formula C36H43N3O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is (2S)-2-[[2-(4-tert-butylphenyl)-2-oxoethyl]amino]-3-[4-[3-(4-heptoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[2-(4-tert-butylphenyl)-2-oxoethyl]amino]-3-[4-[3-(4-heptoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 155084773 |
| Molecular Formula | C36H43N3O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | (2S)-2-[[2-(4-tert-butylphenyl)-2-oxoethyl]amino]-3-[4-[3-(4-heptoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2noc(-c3ccc(C[C@H](NCC(=O)c4ccc(C(C)(C)C)cc4)C(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C36H43N3O5/c1-5-6-7-8-9-22-43-30-20-16-27(17-21-30)33-38-34(44-39-33)28-12-10-25(11-13-28)23-31(35(41)42)37-24-32(40)26-14-18-29(19-15-26)36(2,3)4/h10-21,31,37H,5-9,22-24H2,1-4H3,(H,41,42)/t31-/m0/s1 |
| InChIKey | VVACQYIAHLTNTM-HKBQPEDESA-N |
| XLogP | 7.52 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|