C17H16N2O2 — CID 172720419
2-oxa-3,4-diazabicyclo[14.4.0]icosa-1(20),4,6,8,10,14,16,18-octaen-12-one (PubChem CID 172720419) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-oxa-3,4-diazabicyclo[14.4.0]icosa-1(20),4,6,8,10,14,16,18-octaen-12-one.
| Compound Name | 2-oxa-3,4-diazabicyclo[14.4.0]icosa-1(20),4,6,8,10,14,16,18-octaen-12-one |
|---|---|
| PubChem CID | 172720419 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-oxa-3,4-diazabicyclo[14.4.0]icosa-1(20),4,6,8,10,14,16,18-octaen-12-one |
| SMILES | O=C1C=CC=CC=CC=NNOc2ccccc2C=CC1 |
| InChI | InChI=1S/C17H16N2O2/c20-16-11-4-2-1-3-7-14-18-19-21-17-13-6-5-9-15(17)10-8-12-16/h1-11,13-14,19H,12H2 |
| InChIKey | GKZOIBQMYRYSCB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |