C7H4F6O3 — CID 172722112
3-(1,1,2,2,3,3-hexafluorobutyl)oxetane-2,4-dione (PubChem CID 172722112) has the molecular formula C7H4F6O3 and a molecular weight of 250.09 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3-hexafluorobutyl)oxetane-2,4-dione.
| Compound Name | 3-(1,1,2,2,3,3-hexafluorobutyl)oxetane-2,4-dione |
|---|---|
| PubChem CID | 172722112 |
| Molecular Formula | C7H4F6O3 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3-(1,1,2,2,3,3-hexafluorobutyl)oxetane-2,4-dione |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C1C(=O)OC1=O |
| InChI | InChI=1S/C7H4F6O3/c1-5(8,9)7(12,13)6(10,11)2-3(14)16-4(2)15/h2H,1H3 |
| InChIKey | GQRKBAXUSJWJJF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|