C9H8O5 — CID 88766144
5,5-dimethyl-3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone (PubChem CID 88766144) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is 5,5-dimethyl-3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone.
| Compound Name | 5,5-dimethyl-3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone |
|---|---|
| PubChem CID | 88766144 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5,5-dimethyl-3a,6a-dihydrocyclopenta[c]furan-1,3,4,6-tetrone |
| SMILES | CC1(C)C(=O)C2C(=O)OC(=O)C2C1=O |
| InChI | InChI=1S/C9H8O5/c1-9(2)5(10)3-4(6(9)11)8(13)14-7(3)12/h3-4H,1-2H3 |
| InChIKey | KLWWXOSDMXBHDU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|