C8H2F4O3 — CID 118882412
4,5,6,7-tetrafluoro-3a,7a-dihydro-2-benzofuran-1,3-dione (PubChem CID 118882412) has the molecular formula C8H2F4O3 and a molecular weight of 222.09 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-3a,7a-dihydro-2-benzofuran-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-3a,7a-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 118882412 |
| Molecular Formula | C8H2F4O3 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 4,5,6,7-tetrafluoro-3a,7a-dihydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2C(F)=C(F)C(F)=C(F)C12 |
| InChI | InChI=1S/C8H2F4O3/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11/h1-2H |
| InChIKey | IWPOVPXKFBLDDO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|